C11H13N5O4 — CID 144664797
(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-2-(hydroxymethyl)oxolane-2-carbaldehyde (PubChem CID 144664797) has the molecular formula C11H13N5O4 and a molecular weight of 279.26 g/mol. Its IUPAC name is (2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-2-(hydroxymethyl)oxolane-2-carbaldehyde.
| Compound Name | (2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-2-(hydroxymethyl)oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 144664797 |
| Molecular Formula | C11H13N5O4 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-2-(hydroxymethyl)oxolane-2-carbaldehyde |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@](C=O)(CO)O1 |
| InChI | InChI=1S/C11H13N5O4/c12-9-8-10(14-4-13-9)16(5-15-8)7-1-6(19)11(2-17,3-18)20-7/h2,4-7,18-19H,1,3H2,(H2,12,13,14)/t6-,7+,11+/m0/s1 |
| InChIKey | LIYCNVNCLZHZEN-MVKOHCKWSA-N |
| XLogP | -1.38 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|