C12H14N6O2 — CID 170544097
[(2S,3S,5R)-3-amino-5-(6-aminopurin-9-yl)-2-ethynyloxolan-2-yl]methanol (PubChem CID 170544097) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is [(2S,3S,5R)-3-amino-5-(6-aminopurin-9-yl)-2-ethynyloxolan-2-yl]methanol.
| Compound Name | [(2S,3S,5R)-3-amino-5-(6-aminopurin-9-yl)-2-ethynyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 170544097 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [(2S,3S,5R)-3-amino-5-(6-aminopurin-9-yl)-2-ethynyloxolan-2-yl]methanol |
| SMILES | C#C[C@]1(CO)O[C@@H](n2cnc3c(N)ncnc32)C[C@@H]1N |
| InChI | InChI=1S/C12H14N6O2/c1-2-12(4-19)7(13)3-8(20-12)18-6-17-9-10(14)15-5-16-11(9)18/h1,5-8,19H,3-4,13H2,(H2,14,15,16)/t7-,8+,12+/m0/s1 |
| InChIKey | OUPRBKNVWKBVOI-JOAULVNJSA-N |
| XLogP | -0.98 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|