C17H29N5O3Si — CID 18650236
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloxolan-2-yl]methanol (PubChem CID 18650236) has the molecular formula C17H29N5O3Si and a molecular weight of 379.54 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloxolan-2-yl]methanol.
| Compound Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 18650236 |
| Molecular Formula | C17H29N5O3Si |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloxolan-2-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](n2cnc3c(N)ncnc32)O[C@]1(C)CO |
| InChI | InChI=1S/C17H29N5O3Si/c1-16(2,3)26(5,6)25-11-7-12(24-17(11,4)8-23)22-10-21-13-14(18)19-9-20-15(13)22/h9-12,23H,7-8H2,1-6H3,(H2,18,19,20)/t11-,12+,17+/m0/s1 |
| InChIKey | PECXRNIHIRIRLK-XWCIJXRUSA-N |
| XLogP | 2.47 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|