C16H26FN5O3Si — CID 174057752
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooxolan-2-yl]methanol (PubChem CID 174057752) has the molecular formula C16H26FN5O3Si and a molecular weight of 383.50 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooxolan-2-yl]methanol.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 174057752 |
| Molecular Formula | C16H26FN5O3Si |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooxolan-2-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](F)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C16H26FN5O3Si/c1-16(2,3)26(4,5)25-12-9(6-23)24-15(10(12)17)22-8-21-11-13(18)19-7-20-14(11)22/h7-10,12,15,23H,6H2,1-5H3,(H2,18,19,20)/t9-,10-,12+,15-/m1/s1 |
| InChIKey | LEFBANVCKNZLKN-DSKWVYQCSA-N |
| XLogP | 2.03 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|