C17H28N8O2Si — CID 159630794
9-[(2R,4S,5R)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-amine (PubChem CID 159630794) has the molecular formula C17H28N8O2Si and a molecular weight of 404.55 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,4S,5R)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 159630794 |
| Molecular Formula | C17H28N8O2Si |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 9-[(2R,4S,5R)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-amine |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C(O[Si](C)(C)C(C)(C)C)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C17H28N8O2Si/c1-7-10-11(23-24-19)13(27-28(5,6)17(2,3)4)16(26-10)25-9-22-12-14(18)20-8-21-15(12)25/h8-11,13,16H,7H2,1-6H3,(H2,18,20,21)/t10-,11+,13?,16-/m1/s1 |
| InChIKey | CKZPJBBCEVTZJA-CJMHWFOOSA-N |
| XLogP | 3.79 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|