C22H42N6O4Si — CID 67863411
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-3-ol;N,N-diethylethanamine (PubChem CID 67863411) has the molecular formula C22H42N6O4Si and a molecular weight of 482.70 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-3-ol;N,N-diethylethanamine.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-3-ol;N,N-diethylethanamine |
|---|---|
| PubChem CID | 67863411 |
| Molecular Formula | C22H42N6O4Si |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-3-ol;N,N-diethylethanamine |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1CO.CCN(CC)CC |
| InChI | InChI=1S/C16H27N5O4Si.C6H15N/c1-16(2,3)26(4,5)25-12-9(6-22)24-15(11(12)23)21-8-20-10-13(17)18-7-19-14(10)21;1-4-7(5-2)6-3/h7-9,11-12,15,22-23H,6H2,1-5H3,(H2,17,18,19);4-6H2,1-3H3/t9-,11-,12-,15-;/m1./s1 |
| InChIKey | GPSIQNLJMSMLGE-DNBRLMRSSA-N |
| XLogP | 2.40 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|