C15H26N6O5 — CID 69018733
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;2-(dimethylamino)propan-2-ol (PubChem CID 69018733) has the molecular formula C15H26N6O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;2-(dimethylamino)propan-2-ol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;2-(dimethylamino)propan-2-ol |
|---|---|
| PubChem CID | 69018733 |
| Molecular Formula | C15H26N6O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;2-(dimethylamino)propan-2-ol |
| SMILES | CN(C)C(C)(C)O.Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H13N5O4.C5H13NO/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;1-5(2,7)6(3)4/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);7H,1-4H3/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | ZLPODDWPPDQFMV-MCDZGGTQSA-N |
| XLogP | -1.70 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|