C22H40ClN5O3Si2 — CID 177352538
9-[(2R,3R,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(chloromethyl)oxolan-2-yl]purin-6-amine (PubChem CID 177352538) has the molecular formula C22H40ClN5O3Si2 and a molecular weight of 514.22 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(chloromethyl)oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,3R,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(chloromethyl)oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 177352538 |
| Molecular Formula | C22H40ClN5O3Si2 |
| Molecular Weight | 514.22 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 9-[(2R,3R,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(chloromethyl)oxolan-2-yl]purin-6-amine |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCl)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C22H40ClN5O3Si2/c1-21(2,3)32(7,8)30-16-14(11-23)29-20(17(16)31-33(9,10)22(4,5)6)28-13-27-15-18(24)25-12-26-19(15)28/h12-14,16-17,20H,11H2,1-10H3,(H2,24,25,26)/t14-,16-,17-,20-/m1/s1 |
| InChIKey | DGFNSHFQJDMFAB-WVSUBDOOSA-N |
| XLogP | 5.33 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.22 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|