C16H27N5O4Si — CID 163737131
9-[(2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroperoxy-4-methyloxolan-2-yl]purin-6-amine (PubChem CID 163737131) has the molecular formula C16H27N5O4Si and a molecular weight of 381.51 g/mol. Its IUPAC name is 9-[(2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroperoxy-4-methyloxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroperoxy-4-methyloxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 163737131 |
| Molecular Formula | C16H27N5O4Si |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 9-[(2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroperoxy-4-methyloxolan-2-yl]purin-6-amine |
| SMILES | CC1[C@@H](OO)O[C@@H](n2cnc3c(N)ncnc32)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H27N5O4Si/c1-9-11(25-26(5,6)16(2,3)4)14(23-15(9)24-22)21-8-20-10-12(17)18-7-19-13(10)21/h7-9,11,14-15,22H,1-6H3,(H2,17,18,19)/t9?,11-,14-,15-/m1/s1 |
| InChIKey | WGMFHVURYPJDFG-NJQGAQSKSA-N |
| XLogP | 2.78 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|