C17H26FN5O4Si — CID 174010666
methyl (2S,4R,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooxolane-2-carboxylate (PubChem CID 174010666) has the molecular formula C17H26FN5O4Si and a molecular weight of 411.51 g/mol. Its IUPAC name is methyl (2S,4R,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooxolane-2-carboxylate.
| Compound Name | methyl (2S,4R,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooxolane-2-carboxylate |
|---|---|
| PubChem CID | 174010666 |
| Molecular Formula | C17H26FN5O4Si |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | methyl (2S,4R,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooxolane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](F)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H26FN5O4Si/c1-17(2,3)28(5,6)27-11-9(18)15(26-12(11)16(24)25-4)23-8-22-10-13(19)20-7-21-14(10)23/h7-9,11-12,15H,1-6H3,(H2,19,20,21)/t9-,11?,12+,15-/m1/s1 |
| InChIKey | GZGYQJSDAXHHTA-BWIWHEPQSA-N |
| XLogP | 2.21 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|