C17H29N5O2Si — CID 163886301
9-[(2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-amine (PubChem CID 163886301) has the molecular formula C17H29N5O2Si and a molecular weight of 363.54 g/mol. Its IUPAC name is 9-[(2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 163886301 |
| Molecular Formula | C17H29N5O2Si |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 9-[(2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]purin-6-amine |
| SMILES | CC[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](n2cnc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C17H29N5O2Si/c1-7-11-8-12(24-25(5,6)17(2,3)4)16(23-11)22-10-21-13-14(18)19-9-20-15(13)22/h9-12,16H,7-8H2,1-6H3,(H2,18,19,20)/t11-,12-,16-/m1/s1 |
| InChIKey | KXTMIGIYLFLXGB-XHBSWPGZSA-N |
| XLogP | 3.50 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|