C16H27N6O3+ — CID 149170503
2-[(2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[(propan-2-ylamino)methyl]oxolan-3-yl]oxypropan-2-yloxidanium (PubChem CID 149170503) has the molecular formula C16H27N6O3+ and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-[(2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[(propan-2-ylamino)methyl]oxolan-3-yl]oxypropan-2-yloxidanium.
| Compound Name | 2-[(2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[(propan-2-ylamino)methyl]oxolan-3-yl]oxypropan-2-yloxidanium |
|---|---|
| PubChem CID | 149170503 |
| Molecular Formula | C16H27N6O3+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 2-[(2R,3R,5S)-2-(6-aminopurin-9-yl)-5-[(propan-2-ylamino)methyl]oxolan-3-yl]oxypropan-2-yloxidanium |
| SMILES | CC(C)NC[C@@H]1C[C@@H](OC(C)(C)[OH2+])[C@H](n2cnc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C16H26N6O3/c1-9(2)18-6-10-5-11(25-16(3,4)23)15(24-10)22-8-21-12-13(17)19-7-20-14(12)22/h7-11,15,18,23H,5-6H2,1-4H3,(H2,17,19,20)/p+1/t10-,11+,15+/m0/s1 |
| InChIKey | WYYSTUCYZVHACI-FIXISWKDSA-O |
| XLogP | 0.54 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|