C20H30N6O2 — CID 123537196
9-[6-[(propan-2-ylamino)methyl]spiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-4-yl]purin-6-amine (PubChem CID 123537196) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 9-[6-[(propan-2-ylamino)methyl]spiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-4-yl]purin-6-amine.
| Compound Name | 9-[6-[(propan-2-ylamino)methyl]spiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-4-yl]purin-6-amine |
|---|---|
| PubChem CID | 123537196 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 9-[6-[(propan-2-ylamino)methyl]spiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-4-yl]purin-6-amine |
| SMILES | CC(C)NCC1CC(n2cnc3c(N)ncnc32)C2OC3(CCCCC3)OC12 |
| InChI | InChI=1S/C20H30N6O2/c1-12(2)22-9-13-8-14(26-11-25-15-18(21)23-10-24-19(15)26)17-16(13)27-20(28-17)6-4-3-5-7-20/h10-14,16-17,22H,3-9H2,1-2H3,(H2,21,23,24) |
| InChIKey | MOBLTJQXYRGANE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |