C11H15N5O3 — CID 67785258
[(2R,5R)-5-(6-aminopurin-9-yl)-2-methoxyoxolan-2-yl]methanol (PubChem CID 67785258) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is [(2R,5R)-5-(6-aminopurin-9-yl)-2-methoxyoxolan-2-yl]methanol.
| Compound Name | [(2R,5R)-5-(6-aminopurin-9-yl)-2-methoxyoxolan-2-yl]methanol |
|---|---|
| PubChem CID | 67785258 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | [(2R,5R)-5-(6-aminopurin-9-yl)-2-methoxyoxolan-2-yl]methanol |
| SMILES | CO[C@]1(CO)CC[C@H](n2cnc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C11H15N5O3/c1-18-11(4-17)3-2-7(19-11)16-6-15-8-9(12)13-5-14-10(8)16/h5-7,17H,2-4H2,1H3,(H2,12,13,14)/t7-,11-/m1/s1 |
| InChIKey | JYGOJXYYZVPBPO-RDDDGLTNSA-N |
| XLogP | 0.05 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |