C10H13N5O2 — CID 135258304
[(5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methanol (PubChem CID 135258304) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is [(5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methanol.
| Compound Name | [(5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 135258304 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | [(5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methanol |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CCC(CO)O1 |
| InChI | InChI=1S/C10H13N5O2/c11-9-8-10(13-4-12-9)15(5-14-8)7-2-1-6(3-16)17-7/h4-7,16H,1-3H2,(H2,11,12,13)/t6?,7-/m1/s1 |
| InChIKey | WVXRAFOPTSTNLL-COBSHVIPSA-N |
| XLogP | 0.08 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |