C11H15N7OS — CID 142299425
[(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methylthiourea (PubChem CID 142299425) has the molecular formula C11H15N7OS and a molecular weight of 293.36 g/mol. Its IUPAC name is [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methylthiourea.
| Compound Name | [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methylthiourea |
|---|---|
| PubChem CID | 142299425 |
| Molecular Formula | C11H15N7OS |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methylthiourea |
| SMILES | NC(=S)NC[C@@H]1CC[C@H](n2cnc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C11H15N7OS/c12-9-8-10(16-4-15-9)18(5-17-8)7-2-1-6(19-7)3-14-11(13)20/h4-7H,1-3H2,(H2,12,15,16)(H3,13,14,20)/t6-,7+/m0/s1 |
| InChIKey | IEOLXQDUEKZZCA-NKWVEPMBSA-N |
| XLogP | -0.08 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|