C16H23N7O — CID 145365104
9-[5-(2,5-diazaspiro[3.4]octan-2-ylmethyl)oxolan-2-yl]purin-6-amine (PubChem CID 145365104) has the molecular formula C16H23N7O and a molecular weight of 329.41 g/mol. Its IUPAC name is 9-[5-(2,5-diazaspiro[3.4]octan-2-ylmethyl)oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[5-(2,5-diazaspiro[3.4]octan-2-ylmethyl)oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 145365104 |
| Molecular Formula | C16H23N7O |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 9-[5-(2,5-diazaspiro[3.4]octan-2-ylmethyl)oxolan-2-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2C1CCC(CN2CC3(CCCN3)C2)O1 |
| InChI | InChI=1S/C16H23N7O/c17-14-13-15(19-9-18-14)23(10-20-13)12-3-2-11(24-12)6-22-7-16(8-22)4-1-5-21-16/h9-12,21H,1-8H2,(H2,17,18,19) |
| InChIKey | RSEFFEKYIOKDAZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |