C22H25N7O2 — CID 145365076
N-[9-[5-(1,6-diazaspiro[3.3]heptan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 145365076) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is N-[9-[5-(1,6-diazaspiro[3.3]heptan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[5-(1,6-diazaspiro[3.3]heptan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 145365076 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-[9-[5-(1,6-diazaspiro[3.3]heptan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | O=C(Nc1ncnc2c1ncn2C1CCC(CN2CC3(CCN3)C2)O1)c1ccccc1 |
| InChI | InChI=1S/C22H25N7O2/c30-21(15-4-2-1-3-5-15)27-19-18-20(24-13-23-19)29(14-25-18)17-7-6-16(31-17)10-28-11-22(12-28)8-9-26-22/h1-5,13-14,16-17,26H,6-12H2,(H,23,24,27,30) |
| InChIKey | RHYZGBNHCOMMJU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |