C17H17N5O4 — CID 119080291
N-[9-[(2R,3R,4S,5R)-3-deuterio-5-[deuterio(hydroxy)(113C)methyl]-4-hydroxy(2,3,4,5-13C4)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 119080291) has the molecular formula C17H17N5O4 and a molecular weight of 362.33 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-3-deuterio-5-[deuterio(hydroxy)(113C)methyl]-4-hydroxy(2,3,4,5-13C4)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-3-deuterio-5-[deuterio(hydroxy)(113C)methyl]-4-hydroxy(2,3,4,5-13C4)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 119080291 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-3-deuterio-5-[deuterio(hydroxy)(113C)methyl]-4-hydroxy(2,3,4,5-13C4)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | [2H][13CH](O)[13C@H]1O[13C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[13C@H]([2H])[13C@@H]1O |
| InChI | InChI=1S/C17H17N5O4/c23-7-12-11(24)6-13(26-12)22-9-20-14-15(18-8-19-16(14)22)21-17(25)10-4-2-1-3-5-10/h1-5,8-9,11-13,23-24H,6-7H2,(H,18,19,21,25)/t11-,12+,13+/m0/s1/i6+1D,7+1D,11+1,12+1,13+1/t6-,7?,11+,12-,13-/m1 |
| InChIKey | PIXHJAPVPCVZSV-IEOZRDSBSA-N |
| XLogP | 0.72 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |