C23H31N5O4Si — CID 21177225
N-[9-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 21177225) has the molecular formula C23H31N5O4Si and a molecular weight of 469.62 g/mol. Its IUPAC name is N-[9-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 21177225 |
| Molecular Formula | C23H31N5O4Si |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-[9-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC(n2cnc3c(NC(=O)c4ccccc4)ncnc32)C[C@@H]1O |
| InChI | InChI=1S/C23H31N5O4Si/c1-23(2,3)33(4,5)31-12-17-16(29)11-18(32-17)28-14-26-19-20(24-13-25-21(19)28)27-22(30)15-9-7-6-8-10-15/h6-10,13-14,16-18,29H,11-12H2,1-5H3,(H,24,25,27,30)/t16-,17+,18?/m0/s1 |
| InChIKey | BJZZQJFYKQPUGO-MYFVLZFPSA-N |
| XLogP | 3.75 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|