C23H30IN5O4Si — CID 176808499
N-[9-[(2S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-8-iodopurin-6-yl]benzamide (PubChem CID 176808499) has the molecular formula C23H30IN5O4Si and a molecular weight of 595.51 g/mol. Its IUPAC name is N-[9-[(2S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-8-iodopurin-6-yl]benzamide.
| Compound Name | N-[9-[(2S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-8-iodopurin-6-yl]benzamide |
|---|---|
| PubChem CID | 176808499 |
| Molecular Formula | C23H30IN5O4Si |
| Molecular Weight | 595.51 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | N-[9-[(2S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-8-iodopurin-6-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@H](n2c(I)nc3c(NC(=O)c4ccccc4)ncnc32)C[C@@H]1O |
| InChI | InChI=1S/C23H30IN5O4Si/c1-23(2,3)34(4,5)32-12-16-15(30)11-17(33-16)29-20-18(27-22(29)24)19(25-13-26-20)28-21(31)14-9-7-6-8-10-14/h6-10,13,15-17,30H,11-12H2,1-5H3,(H,25,26,28,31)/t15-,16-,17-/m0/s1 |
| InChIKey | NJSWKARQRUBVHC-ULQDDVLXSA-N |
| XLogP | 4.35 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|