C18H17IN8O4 — CID 176808439
N-[9-[(2S,4S,5S)-4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-8-iodopurin-6-yl]benzamide (PubChem CID 176808439) has the molecular formula C18H17IN8O4 and a molecular weight of 536.29 g/mol. Its IUPAC name is N-[9-[(2S,4S,5S)-4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-8-iodopurin-6-yl]benzamide.
| Compound Name | N-[9-[(2S,4S,5S)-4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-8-iodopurin-6-yl]benzamide |
|---|---|
| PubChem CID | 176808439 |
| Molecular Formula | C18H17IN8O4 |
| Molecular Weight | 536.29 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | N-[9-[(2S,4S,5S)-4-(azidomethoxy)-5-(hydroxymethyl)oxolan-2-yl]-8-iodopurin-6-yl]benzamide |
| SMILES | [N-]=[N+]=NCO[C@H]1C[C@@H](n2c(I)nc3c(NC(=O)c4ccccc4)ncnc32)O[C@H]1CO |
| InChI | InChI=1S/C18H17IN8O4/c19-18-24-14-15(25-17(29)10-4-2-1-3-5-10)21-8-22-16(14)27(18)13-6-11(12(7-28)31-13)30-9-23-26-20/h1-5,8,11-13,28H,6-7,9H2,(H,21,22,25,29)/t11-,12-,13-/m0/s1 |
| InChIKey | QRNVFFUZGPPZPN-AVGNSLFASA-N |
| XLogP | 2.62 |
| TPSA | 160.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|