C46H45N7O8 — CID 102392194
[(2R,3S,5R)-5-[6-benzamido-8-[2-[1-[bis(4-methoxyphenyl)-phenylmethyl]imidazol-4-yl]ethyl]purin-9-yl]-2-(hydroxymethyl)oxolan-3-yl] 2-methoxyacetate (PubChem CID 102392194) has the molecular formula C46H45N7O8 and a molecular weight of 823.91 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[6-benzamido-8-[2-[1-[bis(4-methoxyphenyl)-phenylmethyl]imidazol-4-yl]ethyl]purin-9-yl]-2-(hydroxymethyl)oxolan-3-yl] 2-methoxyacetate.
| Compound Name | [(2R,3S,5R)-5-[6-benzamido-8-[2-[1-[bis(4-methoxyphenyl)-phenylmethyl]imidazol-4-yl]ethyl]purin-9-yl]-2-(hydroxymethyl)oxolan-3-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 102392194 |
| Molecular Formula | C46H45N7O8 |
| Molecular Weight | 823.91 g/mol |
| Exact Mass | 823.33 |
| IUPAC Name | [(2R,3S,5R)-5-[6-benzamido-8-[2-[1-[bis(4-methoxyphenyl)-phenylmethyl]imidazol-4-yl]ethyl]purin-9-yl]-2-(hydroxymethyl)oxolan-3-yl] 2-methoxyacetate |
| SMILES | COCC(=O)O[C@H]1C[C@H](n2c(CCc3cn(C(c4ccccc4)(c4ccc(OC)cc4)c4ccc(OC)cc4)cn3)nc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C46H45N7O8/c1-57-27-41(55)61-37-24-40(60-38(37)26-54)53-39(50-42-43(47-28-48-44(42)53)51-45(56)30-10-6-4-7-11-30)23-18-34-25-52(29-49-34)46(31-12-8-5-9-13-31,32-14-19-35(58-2)20-15-32)33-16-21-36(59-3)22-17-33/h4-17,19-22,25,28-29,37-38,40,54H,18,23-24,26-27H2,1-3H3,(H,47,48,51,56)/t37-,38+,40+/m0/s1 |
| InChIKey | NBCCNEFYYHBAQP-PQTOBSADSA-N |
| XLogP | 5.76 |
| TPSA | 173.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.91 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|