C20H21N5O6 — CID 10960915
[(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-methoxyacetate (PubChem CID 10960915) has the molecular formula C20H21N5O6 and a molecular weight of 427.42 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-methoxyacetate.
| Compound Name | [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 10960915 |
| Molecular Formula | C20H21N5O6 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-methoxyacetate |
| SMILES | COCC(=O)O[C@H]1C[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C20H21N5O6/c1-29-9-16(27)31-13-7-15(30-14(13)8-26)25-11-23-17-18(21-10-22-19(17)25)24-20(28)12-5-3-2-4-6-12/h2-6,10-11,13-15,26H,7-9H2,1H3,(H,21,22,24,28)/t13-,14+,15+/m0/s1 |
| InChIKey | AFWZUZISRRYBFB-RRFJBIMHSA-N |
| XLogP | 0.92 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |