C38H34BrN5O6 — CID 14656958
N-[9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-8-bromopurin-6-yl]benzamide (PubChem CID 14656958) has the molecular formula C38H34BrN5O6 and a molecular weight of 736.62 g/mol. Its IUPAC name is N-[9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-8-bromopurin-6-yl]benzamide.
| Compound Name | N-[9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-8-bromopurin-6-yl]benzamide |
|---|---|
| PubChem CID | 14656958 |
| Molecular Formula | C38H34BrN5O6 |
| Molecular Weight | 736.62 g/mol |
| Exact Mass | 735.17 |
| IUPAC Name | N-[9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-8-bromopurin-6-yl]benzamide |
| SMILES | COc1ccc(C(OCC2OC(n3c(Br)nc4c(NC(=O)c5ccccc5)ncnc43)CC2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H34BrN5O6/c1-47-28-17-13-26(14-18-28)38(25-11-7-4-8-12-25,27-15-19-29(48-2)20-16-27)49-22-31-30(45)21-32(50-31)44-35-33(42-37(44)39)34(40-23-41-35)43-36(46)24-9-5-3-6-10-24/h3-20,23,30-32,45H,21-22H2,1-2H3,(H,40,41,43,46) |
| InChIKey | FFUDCIXZEUGJLO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.62 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|