C31H30BrN5O6 — CID 135992707
2-amino-9-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-8-bromo-1H-purin-6-one (PubChem CID 135992707) has the molecular formula C31H30BrN5O6 and a molecular weight of 648.51 g/mol. Its IUPAC name is 2-amino-9-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-8-bromo-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-8-bromo-1H-purin-6-one |
|---|---|
| PubChem CID | 135992707 |
| Molecular Formula | C31H30BrN5O6 |
| Molecular Weight | 648.51 g/mol |
| Exact Mass | 647.14 |
| IUPAC Name | 2-amino-9-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-8-bromo-1H-purin-6-one |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3c(Br)nc4c(=O)[nH]c(N)nc43)CC2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H30BrN5O6/c1-40-21-12-8-19(9-13-21)31(18-6-4-3-5-7-18,20-10-14-22(41-2)15-11-20)42-17-24-23(38)16-25(43-24)37-27-26(34-29(37)32)28(39)36-30(33)35-27/h3-15,23-25,38H,16-17H2,1-2H3,(H3,33,35,36,39)/t23?,24-,25-/m1/s1 |
| InChIKey | OWZNQARRPYWGMZ-OPWSDZRHSA-N |
| XLogP | 4.14 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|