C33H37N7O6 — CID 135992706
2-amino-8-(2-aminoethylamino)-9-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 135992706) has the molecular formula C33H37N7O6 and a molecular weight of 627.70 g/mol. Its IUPAC name is 2-amino-8-(2-aminoethylamino)-9-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-8-(2-aminoethylamino)-9-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135992706 |
| Molecular Formula | C33H37N7O6 |
| Molecular Weight | 627.70 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | 2-amino-8-(2-aminoethylamino)-9-[(2R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3c(NCCN)nc4c(=O)[nH]c(N)nc43)CC2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H37N7O6/c1-43-23-12-8-21(9-13-23)33(20-6-4-3-5-7-20,22-10-14-24(44-2)15-11-22)45-19-26-25(41)18-27(46-26)40-29-28(30(42)39-31(35)38-29)37-32(40)36-17-16-34/h3-15,25-27,41H,16-19,34H2,1-2H3,(H,36,37)(H3,35,38,39,42)/t25?,26-,27-/m1/s1 |
| InChIKey | JBQZNFKTNCYLKQ-NODVFIEMSA-N |
| XLogP | 2.75 |
| TPSA | 184.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.70 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|