C44H41N5O6 — CID 135490547
9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-[(3-phenylphenyl)methylamino]-1H-purin-6-one (PubChem CID 135490547) has the molecular formula C44H41N5O6 and a molecular weight of 735.84 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-[(3-phenylphenyl)methylamino]-1H-purin-6-one.
| Compound Name | 9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-[(3-phenylphenyl)methylamino]-1H-purin-6-one |
|---|---|
| PubChem CID | 135490547 |
| Molecular Formula | C44H41N5O6 |
| Molecular Weight | 735.84 g/mol |
| Exact Mass | 735.31 |
| IUPAC Name | 9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-[(3-phenylphenyl)methylamino]-1H-purin-6-one |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(NCc5cccc(-c6ccccc6)c5)nc43)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C44H41N5O6/c1-52-35-20-16-33(17-21-35)44(32-14-7-4-8-15-32,34-18-22-36(53-2)23-19-34)54-27-38-37(50)25-39(55-38)49-28-46-40-41(49)47-43(48-42(40)51)45-26-29-10-9-13-31(24-29)30-11-5-3-6-12-30/h3-24,28,37-39,50H,25-27H2,1-2H3,(H2,45,47,48,51)/t37-,38+,39+/m0/s1 |
| InChIKey | UZQKGDMIQAVDOG-LCKTVPPXSA-N |
| XLogP | 7.07 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.84 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|