C39H38N6O7 — CID 139631709
[2-amino-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]purin-6-yl] N-benzylcarbamate (PubChem CID 139631709) has the molecular formula C39H38N6O7 and a molecular weight of 702.77 g/mol. Its IUPAC name is [2-amino-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]purin-6-yl] N-benzylcarbamate.
| Compound Name | [2-amino-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]purin-6-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 139631709 |
| Molecular Formula | C39H38N6O7 |
| Molecular Weight | 702.77 g/mol |
| Exact Mass | 702.28 |
| IUPAC Name | [2-amino-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]purin-6-yl] N-benzylcarbamate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(OC(=O)NCc5ccccc5)nc(N)nc43)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H38N6O7/c1-48-29-17-13-27(14-18-29)39(26-11-7-4-8-12-26,28-15-19-30(49-2)20-16-28)50-23-32-31(46)21-33(51-32)45-24-42-34-35(45)43-37(40)44-36(34)52-38(47)41-22-25-9-5-3-6-10-25/h3-20,24,31-33,46H,21-23H2,1-2H3,(H,41,47)(H2,40,43,44)/t31-,32+,33+/m0/s1 |
| InChIKey | IERSPPOKFDNMCN-WIHCDAFUSA-N |
| XLogP | 5.37 |
| TPSA | 165.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.77 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|