C38H37N3O8 — CID 10484528
benzyl N-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 10484528) has the molecular formula C38H37N3O8 and a molecular weight of 663.73 g/mol. Its IUPAC name is benzyl N-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | benzyl N-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 10484528 |
| Molecular Formula | C38H37N3O8 |
| Molecular Weight | 663.73 g/mol |
| Exact Mass | 663.26 |
| IUPAC Name | benzyl N-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(NC(=O)OCc4ccccc4)nc3=O)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H37N3O8/c1-45-30-17-13-28(14-18-30)38(27-11-7-4-8-12-27,29-15-19-31(46-2)20-16-29)48-25-33-32(42)23-35(49-33)41-22-21-34(39-36(41)43)40-37(44)47-24-26-9-5-3-6-10-26/h3-22,32-33,35,42H,23-25H2,1-2H3,(H,39,40,43,44)/t32-,33+,35+/m0/s1 |
| InChIKey | QIAUWOVPABNQAI-VUHKNJSWSA-N |
| XLogP | 5.67 |
| TPSA | 130.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.73 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|