C41H38N4O7 — CID 163296358
1-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]-3-naphthalen-2-ylurea (PubChem CID 163296358) has the molecular formula C41H38N4O7 and a molecular weight of 698.78 g/mol. Its IUPAC name is 1-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]-3-naphthalen-2-ylurea.
| Compound Name | 1-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]-3-naphthalen-2-ylurea |
|---|---|
| PubChem CID | 163296358 |
| Molecular Formula | C41H38N4O7 |
| Molecular Weight | 698.78 g/mol |
| Exact Mass | 698.27 |
| IUPAC Name | 1-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]-3-naphthalen-2-ylurea |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(NC(=O)Nc4ccc5ccccc5c4)nc3=O)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H38N4O7/c1-49-33-18-13-30(14-19-33)41(29-10-4-3-5-11-29,31-15-20-34(50-2)21-16-31)51-26-36-35(46)25-38(52-36)45-23-22-37(44-40(45)48)43-39(47)42-32-17-12-27-8-6-7-9-28(27)24-32/h3-24,35-36,38,46H,25-26H2,1-2H3,(H2,42,43,44,47,48)/t35-,36+,38+/m0/s1 |
| InChIKey | RMQYKGDTAXSQEY-QOZRZDGHSA-N |
| XLogP | 6.71 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.78 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|