C35H33N3O7S — CID 11050513
N-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]thiophene-2-carboxamide (PubChem CID 11050513) has the molecular formula C35H33N3O7S and a molecular weight of 639.73 g/mol. Its IUPAC name is N-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11050513 |
| Molecular Formula | C35H33N3O7S |
| Molecular Weight | 639.73 g/mol |
| Exact Mass | 639.20 |
| IUPAC Name | N-[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]thiophene-2-carboxamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(NC(=O)c4cccs4)nc3=O)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H33N3O7S/c1-42-26-14-10-24(11-15-26)35(23-7-4-3-5-8-23,25-12-16-27(43-2)17-13-25)44-22-29-28(39)21-32(45-29)38-19-18-31(37-34(38)41)36-33(40)30-9-6-20-46-30/h3-20,28-29,32,39H,21-22H2,1-2H3,(H,36,37,40,41)/t28-,29+,32+/m0/s1 |
| InChIKey | FJYFQTLJMQFNTQ-NPLMNSEMSA-N |
| XLogP | 5.23 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.73 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|