C37H34N3O10P-2 — CID 134885514
[(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] phosphate (PubChem CID 134885514) has the molecular formula C37H34N3O10P-2 and a molecular weight of 711.66 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] phosphate.
| Compound Name | [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] phosphate |
|---|---|
| PubChem CID | 134885514 |
| Molecular Formula | C37H34N3O10P-2 |
| Molecular Weight | 711.66 g/mol |
| Exact Mass | 711.20 |
| IUPAC Name | [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] phosphate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(NC(=O)c4ccccc4)nc3=O)C[C@@H]2OP(=O)([O-])[O-])(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H36N3O10P/c1-46-29-17-13-27(14-18-29)37(26-11-7-4-8-12-26,28-15-19-30(47-2)20-16-28)48-24-32-31(50-51(43,44)45)23-34(49-32)40-22-21-33(39-36(40)42)38-35(41)25-9-5-3-6-10-25/h3-22,31-32,34H,23-24H2,1-2H3,(H2,43,44,45)(H,38,39,41,42)/p-2/t31-,32+,34+/m0/s1 |
| InChIKey | JCWUPJDNXCAOPG-VOTWKOMSSA-L |
| XLogP | 4.02 |
| TPSA | 173.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.66 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|