C42H41N3O9 — CID 118483571
[5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] 4-oxopentanoate (PubChem CID 118483571) has the molecular formula C42H41N3O9 and a molecular weight of 731.80 g/mol. Its IUPAC name is [5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] 4-oxopentanoate.
| Compound Name | [5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 118483571 |
| Molecular Formula | C42H41N3O9 |
| Molecular Weight | 731.80 g/mol |
| Exact Mass | 731.28 |
| IUPAC Name | [5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] 4-oxopentanoate |
| SMILES | COc1ccc(C(OCC2OC(n3ccc(NC(=O)c4ccccc4)nc3=O)CC2OC(=O)CCC(C)=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H41N3O9/c1-28(46)14-23-39(47)54-35-26-38(45-25-24-37(44-41(45)49)43-40(48)29-10-6-4-7-11-29)53-36(35)27-52-42(30-12-8-5-9-13-30,31-15-19-33(50-2)20-16-31)32-17-21-34(51-3)22-18-32/h4-13,15-22,24-25,35-36,38H,14,23,26-27H2,1-3H3,(H,43,44,48,49) |
| InChIKey | YRBAGGOZKNHSIA-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 144.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.80 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|