C44H43N4O8P — CID 10581116
N-[1-[(2R,4S,5R)-4-[anilino(methyl)phosphoryl]oxy-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 10581116) has the molecular formula C44H43N4O8P and a molecular weight of 786.82 g/mol. Its IUPAC name is N-[1-[(2R,4S,5R)-4-[anilino(methyl)phosphoryl]oxy-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,4S,5R)-4-[anilino(methyl)phosphoryl]oxy-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 10581116 |
| Molecular Formula | C44H43N4O8P |
| Molecular Weight | 786.82 g/mol |
| Exact Mass | 786.28 |
| IUPAC Name | N-[1-[(2R,4S,5R)-4-[anilino(methyl)phosphoryl]oxy-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(NC(=O)c4ccccc4)nc3=O)C[C@@H]2O[P@](C)(=O)Nc2ccccc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C44H43N4O8P/c1-52-36-23-19-33(20-24-36)44(32-15-9-5-10-16-32,34-21-25-37(53-2)26-22-34)54-30-39-38(56-57(3,51)47-35-17-11-6-12-18-35)29-41(55-39)48-28-27-40(46-43(48)50)45-42(49)31-13-7-4-8-14-31/h4-28,38-39,41H,29-30H2,1-3H3,(H,47,51)(H,45,46,49,50)/t38-,39+,41+,57-/m0/s1 |
| InChIKey | QLVYWLSWUWVXFE-DCVBUBRGSA-N |
| XLogP | 8.13 |
| TPSA | 139.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.82 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|