C41H40N4O10P+ — CID 14778847
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[4-[(4-methoxybenzoyl)amino]-2-oxopyrimidin-1-yl]oxolan-3-yl]oxy-(2-cyanoethoxy)-oxophosphanium (PubChem CID 14778847) has the molecular formula C41H40N4O10P+ and a molecular weight of 779.76 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[4-[(4-methoxybenzoyl)amino]-2-oxopyrimidin-1-yl]oxolan-3-yl]oxy-(2-cyanoethoxy)-oxophosphanium.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[4-[(4-methoxybenzoyl)amino]-2-oxopyrimidin-1-yl]oxolan-3-yl]oxy-(2-cyanoethoxy)-oxophosphanium |
|---|---|
| PubChem CID | 14778847 |
| Molecular Formula | C41H40N4O10P+ |
| Molecular Weight | 779.76 g/mol |
| Exact Mass | 779.25 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[4-[(4-methoxybenzoyl)amino]-2-oxopyrimidin-1-yl]oxolan-3-yl]oxy-(2-cyanoethoxy)-oxophosphanium |
| SMILES | COc1ccc(C(=O)Nc2ccn([C@H]3C[C@H](O[P+](=O)OCCC#N)[C@@H](COC(c4ccccc4)(c4ccc(OC)cc4)c4ccc(OC)cc4)O3)c(=O)n2)cc1 |
| InChI | InChI=1S/C41H39N4O10P/c1-49-32-16-10-28(11-17-32)39(46)43-37-22-24-45(40(47)44-37)38-26-35(55-56(48)53-25-7-23-42)36(54-38)27-52-41(29-8-5-4-6-9-29,30-12-18-33(50-2)19-13-30)31-14-20-34(51-3)21-15-31/h4-6,8-22,24,35-36,38H,7,25-27H2,1-3H3/p+1/t35-,36+,38+/m0/s1 |
| InChIKey | GVQRZCTYISFAAE-QOZRZDGHSA-O |
| XLogP | 6.79 |
| TPSA | 169.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.76 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|