C40H40N5O8P — CID 175675854
[(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-N-(2-cyanoethyl)phosphonamidous acid (PubChem CID 175675854) has the molecular formula C40H40N5O8P and a molecular weight of 749.76 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-N-(2-cyanoethyl)phosphonamidous acid.
| Compound Name | [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-N-(2-cyanoethyl)phosphonamidous acid |
|---|---|
| PubChem CID | 175675854 |
| Molecular Formula | C40H40N5O8P |
| Molecular Weight | 749.76 g/mol |
| Exact Mass | 749.26 |
| IUPAC Name | [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-N-(2-cyanoethyl)phosphonamidous acid |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(NC(=O)c4ccccc4)nc3=O)C[C@@H]2OP(O)NCCC#N)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H40N5O8P/c1-49-32-18-14-30(15-19-32)40(29-12-7-4-8-13-29,31-16-20-33(50-2)21-17-31)51-27-35-34(53-54(48)42-24-9-23-41)26-37(52-35)45-25-22-36(44-39(45)47)43-38(46)28-10-5-3-6-11-28/h3-8,10-22,25,34-35,37,42,48H,9,24,26-27H2,1-2H3,(H,43,44,46,47)/t34-,35+,37+,54?/m0/s1 |
| InChIKey | VDYRRSWODVTNMR-NYQNSEJGSA-N |
| XLogP | 5.92 |
| TPSA | 166.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.76 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|