C43H39N4O12P — CID 10985850
[(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] (4-nitrophenyl) hydrogen phosphate (PubChem CID 10985850) has the molecular formula C43H39N4O12P and a molecular weight of 834.78 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] (4-nitrophenyl) hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] (4-nitrophenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 10985850 |
| Molecular Formula | C43H39N4O12P |
| Molecular Weight | 834.78 g/mol |
| Exact Mass | 834.23 |
| IUPAC Name | [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] (4-nitrophenyl) hydrogen phosphate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(NC(=O)c4ccccc4)nc3=O)C[C@@H]2OP(=O)(O)Oc2ccc([N+](=O)[O-])cc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C43H39N4O12P/c1-54-34-19-13-31(14-20-34)43(30-11-7-4-8-12-30,32-15-21-35(55-2)22-16-32)56-28-38-37(59-60(52,53)58-36-23-17-33(18-24-36)47(50)51)27-40(57-38)46-26-25-39(45-42(46)49)44-41(48)29-9-5-3-6-10-29/h3-26,37-38,40H,27-28H2,1-2H3,(H,52,53)(H,44,45,48,49)/t37-,38+,40+/m0/s1 |
| InChIKey | JNHHIYPSYPOCCF-PQTOBSADSA-N |
| XLogP | 7.28 |
| TPSA | 199.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.78 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|