C34H37N4O8P — CID 67840180
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-N-(2-cyanoethyl)phosphonamidous acid (PubChem CID 67840180) has the molecular formula C34H37N4O8P and a molecular weight of 660.66 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-N-(2-cyanoethyl)phosphonamidous acid.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-N-(2-cyanoethyl)phosphonamidous acid |
|---|---|
| PubChem CID | 67840180 |
| Molecular Formula | C34H37N4O8P |
| Molecular Weight | 660.66 g/mol |
| Exact Mass | 660.23 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-N-(2-cyanoethyl)phosphonamidous acid |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2OP(O)NCCC#N)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H37N4O8P/c1-23-21-38(33(40)37-32(23)39)31-20-29(46-47(41)36-19-7-18-35)30(45-31)22-44-34(24-8-5-4-6-9-24,25-10-14-27(42-2)15-11-25)26-12-16-28(43-3)17-13-26/h4-6,8-17,21,29-31,36,41H,7,19-20,22H2,1-3H3,(H,37,39,40)/t29-,30+,31+,47?/m0/s1 |
| InChIKey | UOSNSQJJHPLWAP-WAGNLWFCSA-N |
| XLogP | 4.27 |
| TPSA | 157.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.66 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|