C36H40ClN2O9P — CID 10628587
[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-chlorophosphanyl] 2,2-dimethylpropanoate (PubChem CID 10628587) has the molecular formula C36H40ClN2O9P and a molecular weight of 711.15 g/mol. Its IUPAC name is [[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-chlorophosphanyl] 2,2-dimethylpropanoate.
| Compound Name | [[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-chlorophosphanyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10628587 |
| Molecular Formula | C36H40ClN2O9P |
| Molecular Weight | 711.15 g/mol |
| Exact Mass | 710.22 |
| IUPAC Name | [[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-chlorophosphanyl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2OP(Cl)OC(=O)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H40ClN2O9P/c1-23-21-39(34(42)38-32(23)40)31-20-29(47-49(37)48-33(41)35(2,3)4)30(46-31)22-45-36(24-10-8-7-9-11-24,25-12-16-27(43-5)17-13-25)26-14-18-28(44-6)19-15-26/h7-19,21,29-31H,20,22H2,1-6H3,(H,38,40,42)/t29-,30+,31+,49?/m0/s1 |
| InChIKey | GNXZKALZRJNBRZ-DJRCZKTHSA-N |
| XLogP | 6.60 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.15 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|