C40H44ClN2O9PSi — CID 10605306
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (4-chlorophenyl) trimethylsilyl phosphite (PubChem CID 10605306) has the molecular formula C40H44ClN2O9PSi and a molecular weight of 791.31 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (4-chlorophenyl) trimethylsilyl phosphite.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (4-chlorophenyl) trimethylsilyl phosphite |
|---|---|
| PubChem CID | 10605306 |
| Molecular Formula | C40H44ClN2O9PSi |
| Molecular Weight | 791.31 g/mol |
| Exact Mass | 790.22 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (4-chlorophenyl) trimethylsilyl phosphite |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2OP(Oc2ccc(Cl)cc2)O[Si](C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H44ClN2O9PSi/c1-27-25-43(39(45)42-38(27)44)37-24-35(51-53(52-54(4,5)6)50-34-22-16-31(41)17-23-34)36(49-37)26-48-40(28-10-8-7-9-11-28,29-12-18-32(46-2)19-13-29)30-14-20-33(47-3)21-15-30/h7-23,25,35-37H,24,26H2,1-6H3,(H,42,44,45)/t35-,36+,37+,53?/m0/s1 |
| InChIKey | BUWKTNZRJCMFBO-CEXSRUIHSA-N |
| XLogP | 8.35 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.31 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|