C34H40N3O9P — CID 11039632
1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-4-(diethoxyphosphorylamino)pyrimidin-2-one (PubChem CID 11039632) has the molecular formula C34H40N3O9P and a molecular weight of 665.68 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-4-(diethoxyphosphorylamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-4-(diethoxyphosphorylamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 11039632 |
| Molecular Formula | C34H40N3O9P |
| Molecular Weight | 665.68 g/mol |
| Exact Mass | 665.25 |
| IUPAC Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-4-(diethoxyphosphorylamino)pyrimidin-2-one |
| SMILES | CCOP(=O)(Nc1ccn([C@H]2C[C@H](O)[C@@H](COC(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)O2)c(=O)n1)OCC |
| InChI | InChI=1S/C34H40N3O9P/c1-5-44-47(40,45-6-2)36-31-20-21-37(33(39)35-31)32-22-29(38)30(46-32)23-43-34(24-10-8-7-9-11-24,25-12-16-27(41-3)17-13-25)26-14-18-28(42-4)19-15-26/h7-21,29-30,32,38H,5-6,22-23H2,1-4H3,(H,35,36,39,40)/t29-,30+,32+/m0/s1 |
| InChIKey | LZAIPPZFQAACLB-XAGDYJCDSA-N |
| XLogP | 5.51 |
| TPSA | 139.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.68 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|