C38H43F3N4O7 — CID 11104544
N-[6-[[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]amino]hexyl]-2,2,2-trifluoroacetamide (PubChem CID 11104544) has the molecular formula C38H43F3N4O7 and a molecular weight of 724.78 g/mol. Its IUPAC name is N-[6-[[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]amino]hexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[6-[[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]amino]hexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11104544 |
| Molecular Formula | C38H43F3N4O7 |
| Molecular Weight | 724.78 g/mol |
| Exact Mass | 724.31 |
| IUPAC Name | N-[6-[[1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]amino]hexyl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(NCCCCCCNC(=O)C(F)(F)F)nc3=O)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H43F3N4O7/c1-49-29-16-12-27(13-17-29)37(26-10-6-5-7-11-26,28-14-18-30(50-2)19-15-28)51-25-32-31(46)24-34(52-32)45-23-20-33(44-36(45)48)42-21-8-3-4-9-22-43-35(47)38(39,40)41/h5-7,10-20,23,31-32,34,46H,3-4,8-9,21-22,24-25H2,1-2H3,(H,43,47)(H,42,44,48)/t31-,32+,34+/m0/s1 |
| InChIKey | XLLRIVVCVZZMAR-VOTWKOMSSA-N |
| XLogP | 5.57 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.78 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|