C32H36N4O6 — CID 13008480
4-(2-aminoethylamino)-1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 13008480) has the molecular formula C32H36N4O6 and a molecular weight of 572.66 g/mol. Its IUPAC name is 4-(2-aminoethylamino)-1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-(2-aminoethylamino)-1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 13008480 |
| Molecular Formula | C32H36N4O6 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | 4-(2-aminoethylamino)-1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(NCCN)nc3=O)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H36N4O6/c1-39-25-12-8-23(9-13-25)32(22-6-4-3-5-7-22,24-10-14-26(40-2)15-11-24)41-21-28-27(37)20-30(42-28)36-19-16-29(34-18-17-33)35-31(36)38/h3-16,19,27-28,30,37H,17-18,20-21,33H2,1-2H3,(H,34,35,38)/t27-,28+,30+/m0/s1 |
| InChIKey | KRJIFMVYGMFAOY-PKZQBKLLSA-N |
| XLogP | 3.29 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|