C47H41N3O4 — CID 101072596
1-[(2R,4S,5R)-4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-4-(tritylamino)pyrimidin-2-one (PubChem CID 101072596) has the molecular formula C47H41N3O4 and a molecular weight of 711.86 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-4-(tritylamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-4-(tritylamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 101072596 |
| Molecular Formula | C47H41N3O4 |
| Molecular Weight | 711.86 g/mol |
| Exact Mass | 711.31 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-4-(tritylamino)pyrimidin-2-one |
| SMILES | O=c1nc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)ccn1[C@H]1C[C@H](O)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C47H41N3O4/c51-41-33-44(54-42(41)34-53-47(38-25-13-4-14-26-38,39-27-15-5-16-28-39)40-29-17-6-18-30-40)50-32-31-43(48-45(50)52)49-46(35-19-7-1-8-20-35,36-21-9-2-10-22-36)37-23-11-3-12-24-37/h1-32,41-42,44,51H,33-34H2,(H,48,49,52)/t41-,42+,44+/m0/s1 |
| InChIKey | XSFHHSYZGOCSHI-RXAPTJIMSA-N |
| XLogP | 8.30 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.86 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|