C31H33N3O7 — CID 68542164
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[tris(4-methoxyphenyl)methylamino]pyrimidin-2-one (PubChem CID 68542164) has the molecular formula C31H33N3O7 and a molecular weight of 559.62 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[tris(4-methoxyphenyl)methylamino]pyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[tris(4-methoxyphenyl)methylamino]pyrimidin-2-one |
|---|---|
| PubChem CID | 68542164 |
| Molecular Formula | C31H33N3O7 |
| Molecular Weight | 559.62 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[tris(4-methoxyphenyl)methylamino]pyrimidin-2-one |
| SMILES | COc1ccc(C(Nc2ccn([C@H]3C[C@H](O)[C@@H](CO)O3)c(=O)n2)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H33N3O7/c1-38-23-10-4-20(5-11-23)31(21-6-12-24(39-2)13-7-21,22-8-14-25(40-3)15-9-22)33-28-16-17-34(30(37)32-28)29-18-26(36)27(19-35)41-29/h4-17,26-27,29,35-36H,18-19H2,1-3H3,(H,32,33,37)/t26-,27+,29+/m0/s1 |
| InChIKey | FREGDEUZNUQMCC-YIKNKFAXSA-N |
| XLogP | 3.31 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.62 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|