C15H25N3O6Si — CID 102072040
2-trimethylsilylethyl N-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 102072040) has the molecular formula C15H25N3O6Si and a molecular weight of 371.47 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 102072040 |
| Molecular Formula | C15H25N3O6Si |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-trimethylsilylethyl N-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | C[Si](C)(C)CCOC(=O)Nc1ccn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)n1 |
| InChI | InChI=1S/C15H25N3O6Si/c1-25(2,3)7-6-23-15(22)17-12-4-5-18(14(21)16-12)13-8-10(20)11(9-19)24-13/h4-5,10-11,13,19-20H,6-9H2,1-3H3,(H,16,17,21,22)/t10-,11+,13+/m0/s1 |
| InChIKey | IMTGIJUDBBUFRC-DMDPSCGWSA-N |
| XLogP | 0.77 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|