C19H30N5O6 — CID 122234032
CID 122234032 (PubChem CID 122234032) has the molecular formula C19H30N5O6 and a molecular weight of 424.48 g/mol.
| Compound Name | CID 122234032 |
|---|---|
| PubChem CID | 122234032 |
| Molecular Formula | C19H30N5O6 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NC(=O)Nc2ccn([C@H]3C[C@H](O)[C@@H](CO)O3)c(=O)n2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C19H30N5O6/c1-18(2)8-11(9-19(3,4)24(18)29)20-16(27)21-14-5-6-23(17(28)22-14)15-7-12(26)13(10-25)30-15/h5-6,11-13,15,25-26H,7-10H2,1-4H3,(H2,20,21,22,27,28)/t12-,13+,15+/m0/s1 |
| InChIKey | ZQBWSUALACNOFY-GZBFAFLISA-N |
| XLogP | 0.37 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |