About CID 122234032
CID 122234032 (PubChem CID 122234032) has the molecular formula C19H30N5O6
and a molecular weight of 424.48 g/mol.
Molecular Properties
| Compound Name | CID 122234032 |
| PubChem CID | 122234032 |
| Molecular Formula | C19H30N5O6 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NC(=O)Nc2ccn([C@H]3C[C@H](O)[C@@H](CO)O3)c(=O)n2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C19H30N5O6/c1-18(2)8-11(9-19(3,4)24(18)29)20-16(27)21-14-5-6-23(17(28)22-14)15-7-12(26)13(10-25)30-15/h5-6,11-13,15,25-26H,7-10H2,1-4H3,(H2,20,21,22,27,28)/t12-,13+,15+/m0/s1 |
| InChIKey | ZQBWSUALACNOFY-GZBFAFLISA-N |
| XLogP | 0.37 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 122234032 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 122234032?
The IUPAC name of CID 122234032 (CID 122234032) is not available.
What is the SMILES notation for CID 122234032?
The canonical SMILES for CID 122234032 is CC1(C)CC(NC(=O)Nc2ccn([C@H]3C[C@H](O)[C@@H](CO)O3)c(=O)n2)CC(C)(C)N1[O].
What is the InChIKey of CID 122234032?
The InChIKey is ZQBWSUALACNOFY-GZBFAFLISA-N. The full InChI is InChI=1S/C19H30N5O6/c1-18(2)8-11(9-19(3,4)24(18)29)20-16(27)21-14-5-6-23(17(28)22-14)15-7-12(26)13(10-25)30-15/h5-6,11-13,15,25-26H,7-10H2,1-4H3,(H2,20,21,22,27,28)/t12-,13+,15+/m0/s1.
What are the key properties of CID 122234032?
CID 122234032 has a molecular weight of 424.48 g/mol, XLogP of 0.37, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 122234032 is sourced from PubChem (CID 122234032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).