C15H23N3O5 — CID 155602775
N-[1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]hexanamide (PubChem CID 155602775) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]hexanamide.
| Compound Name | N-[1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]hexanamide |
|---|---|
| PubChem CID | 155602775 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-[1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccn([C@H]2C[C@@H](O)[C@@H](CO)O2)c(=O)n1 |
| InChI | InChI=1S/C15H23N3O5/c1-2-3-4-5-13(21)16-12-6-7-18(15(22)17-12)14-8-10(20)11(9-19)23-14/h6-7,10-11,14,19-20H,2-5,8-9H2,1H3,(H,16,17,21,22)/t10-,11-,14-/m1/s1 |
| InChIKey | UFMZXKKSIBRLDN-JTNHKYCSSA-N |
| XLogP | 0.40 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|