C17H27N3O6 — CID 46832253
N-[1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]octanamide (PubChem CID 46832253) has the molecular formula C17H27N3O6 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-[1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]octanamide.
| Compound Name | N-[1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]octanamide |
|---|---|
| PubChem CID | 46832253 |
| Molecular Formula | C17H27N3O6 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1ccn([C@@H]2O[C@H](CO)[C@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C17H27N3O6/c1-2-3-4-5-6-7-13(22)18-12-8-9-20(17(25)19-12)16-15(24)14(23)11(10-21)26-16/h8-9,11,14-16,21,23-24H,2-7,10H2,1H3,(H,18,19,22,25)/t11-,14+,15+,16-/m1/s1 |
| InChIKey | WBSYQPAAYPKNEJ-IPOQPSJVSA-N |
| XLogP | 0.15 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|